EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40O17 |
| Net Charge | 0 |
| Average Mass | 708.666 |
| Monoisotopic Mass | 708.22655 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3cc(O)c4c(=O)c(CO)c(-c5cc(O)c(O)c(CC=C(C)C)c5)oc4c3)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H40O17/c1-12(2)3-4-13-5-14(6-18(38)23(13)39)30-16(9-34)24(40)22-17(37)7-15(8-19(22)47-30)46-33-31(28(44)26(42)21(11-36)49-33)50-32-29(45)27(43)25(41)20(10-35)48-32/h3,5-8,20-21,25-29,31-39,41-45H,4,9-11H2,1-2H3/t20-,21-,25-,26-,27+,28+,29-,31-,32+,33-/m1/s1 |
| InChIKey | ZDGISMQFYIDRSP-KZGGGLRYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pedunculosumoside C (CHEBI:67875) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside C (CHEBI:67875) has role anti-HBV agent (CHEBI:64951) |
| pedunculosumoside C (CHEBI:67875) has role plant metabolite (CHEBI:76924) |
| pedunculosumoside C (CHEBI:67875) is a disaccharide derivative (CHEBI:63353) |
| pedunculosumoside C (CHEBI:67875) is a homoflavonoid glycoside (CHEBI:76404) |
| pedunculosumoside C (CHEBI:67875) is a hydroxy homoflavonoid (CHEBI:76405) |
| pedunculosumoside C (CHEBI:67875) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5-hydroxy-3-(hydroxymethyl)-4-oxo-4H-chromen-7-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5'-(3-methyl-2-buten-1-yl)ophioglonol 7-O-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523326 | Reaxys |
| Citations |
|---|