EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H50O22 |
| Net Charge | 0 |
| Average Mass | 870.807 |
| Monoisotopic Mass | 870.27937 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3cc(O)c4c(=O)c(CO)c(-c5cc(O)c(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c(CC=C(C)C)c5)oc4c3)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C39H50O22/c1-13(2)3-4-14-5-15(6-19(45)35(14)60-37-32(53)29(50)26(47)21(10-41)57-37)34-17(9-40)25(46)24-18(44)7-16(8-20(24)56-34)55-39-36(31(52)28(49)23(12-43)59-39)61-38-33(54)30(51)27(48)22(11-42)58-38/h3,5-8,21-23,26-33,36-45,47-54H,4,9-12H2,1-2H3/t21-,22-,23-,26-,27-,28-,29+,30+,31+,32-,33-,36-,37+,38+,39-/m1/s1 |
| InChIKey | XWEFVEFGSLLUFG-LKAUHASFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pedunculosumoside A (CHEBI:67873) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside A (CHEBI:67873) has role anti-HBV agent (CHEBI:64951) |
| pedunculosumoside A (CHEBI:67873) has role plant metabolite (CHEBI:76924) |
| pedunculosumoside A (CHEBI:67873) is a homoflavonoid glycoside (CHEBI:76404) |
| pedunculosumoside A (CHEBI:67873) is a hydroxy homoflavonoid (CHEBI:76405) |
| pedunculosumoside A (CHEBI:67873) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[7-{[2-O-(β-D-glucopyranosyl)-β-D-glucopyranosyl]oxy}-5-hydroxy-3-(hydroxymethyl)-4-oxo-4H-chromen-2-yl]-2-hydroxy-6-(3-methylbut-2-en-1-yl)phenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5'-(3-methyl-2-buten-1-yl)ophioglonol 7-O-β-D-glucopyranosyl-(1→2)-β-D-glucopyranosyl-4'-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523329 | Reaxys |
| Citations |
|---|