EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2S |
| Net Charge | 0 |
| Average Mass | 133.172 |
| Monoisotopic Mass | 133.01975 |
| SMILES | O=C(O)C1CSCN1 |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7) |
| InChIKey | DZLNHFMRPBPULJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioproline (CHEBI:64564) has role antidote (CHEBI:50247) |
| thioproline (CHEBI:64564) has role antioxidant (CHEBI:22586) |
| thioproline (CHEBI:64564) has role hepatoprotective agent (CHEBI:62868) |
| thioproline (CHEBI:64564) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| thioproline (CHEBI:64564) is a sulfur-containing amino acid (CHEBI:26834) |
| thioproline (CHEBI:64564) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| thioproline (CHEBI:64564) is tautomer of thioproline zwitterion (CHEBI:133584) |
| Incoming Relation(s) |
| D-thioproline (CHEBI:64562) is a thioproline (CHEBI:64564) |
| L-thioproline (CHEBI:45171) is a thioproline (CHEBI:64564) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) is a thioproline (CHEBI:64564) |
| thioproline zwitterion (CHEBI:133584) is tautomer of thioproline (CHEBI:64564) |
| IUPAC Name |
|---|
| 1,3-thiazolidine-4-carboxylic acid |
| INNs | Source |
|---|---|
| timonacic | ChemIDplus |
| timonacico | ChemIDplus |
| timonacicum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Carboxythiazolidine | ChemIDplus |
| 4-Thiazolidinecarboxylic acid | ChemIDplus |
| Acide DL thiazolidine carboxylique-4 | ChemIDplus |
| Acide thiazolidine-4-carboxylique | ChemIDplus |
| DL-Thiaproline | ChemIDplus |
| DL-Thiazolidinecarboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2670 | DrugCentral |
| D08601 | KEGG DRUG |
| US2009298895 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81066 | Reaxys |
| CAS:444-27-9 | ChemIDplus |
| Citations |
|---|