EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2S |
| Net Charge | 0 |
| Average Mass | 133.172 |
| Monoisotopic Mass | 133.01975 |
| SMILES | O=C([O-])C1CSC[NH2+]1 |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7) |
| InChIKey | DZLNHFMRPBPULJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioproline zwitterion (CHEBI:133584) has role antidote (CHEBI:50247) |
| thioproline zwitterion (CHEBI:133584) has role antioxidant (CHEBI:22586) |
| thioproline zwitterion (CHEBI:133584) is a α-amino-acid zwitterion (CHEBI:78608) |
| thioproline zwitterion (CHEBI:133584) is tautomer of thioproline (CHEBI:64564) |
| Incoming Relation(s) |
| thioproline (CHEBI:64564) is tautomer of thioproline zwitterion (CHEBI:133584) |
| IUPAC Name |
|---|
| 1,3-thiazolidin-3-ium-4-carboxylate |
| Synonym | Source |
|---|---|
| thiaproline zwitterion | ChEBI |