EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2S |
| Net Charge | 0 |
| Average Mass | 133.172 |
| Monoisotopic Mass | 133.01975 |
| SMILES | O=C(O)[C@H]1CSCN1 |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1 |
| InChIKey | DZLNHFMRPBPULJ-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-thioproline (CHEBI:64562) has role antioxidant (CHEBI:22586) |
| D-thioproline (CHEBI:64562) is a D-α-amino acid (CHEBI:16733) |
| D-thioproline (CHEBI:64562) is a thioproline (CHEBI:64564) |
| IUPAC Name |
|---|
| (4S)-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| (S)-4-Thiazolidinecarboxylic acid | ChemIDplus |
| D-Thiazolidine-4-carboxylic acid | ChemIDplus |
| Acide D thiazolidine carboxylique-4 | ChemIDplus |
| (4S)-4-thiazolidinecarboxylic acid | ChEBI |
| (S)-(+)-4-thiazolidinecarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB02846 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5476836 | Reaxys |
| CAS:45521-09-3 | ChemIDplus |