EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO5S2 |
| Net Charge | 0 |
| Average Mass | 227.263 |
| Monoisotopic Mass | 226.99221 |
| SMILES | O=C(O)[C@@H]1CSC(CS(=O)(=O)O)N1 |
| InChI | InChI=1S/C5H9NO5S2/c7-5(8)3-1-12-4(6-3)2-13(9,10)11/h3-4,6H,1-2H2,(H,7,8)(H,9,10,11)/t3-,4?/m0/s1 |
| InChIKey | HYGZRLVEUKTESI-WUCPZUCCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) has functional parent L-thioproline (CHEBI:45171) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) has role metabolite (CHEBI:25212) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) is a organosulfonic acid (CHEBI:33551) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) is a thioproline (CHEBI:64564) |
| IUPAC Name |
|---|
| (4R)-2-(sulfomethyl)-1,3-thiazolidine-4-carboxylic acid |
| Synonym | Source |
|---|---|
| 2-(sulfomethyl)thiazolidine-4-carboxylic acid | ChEBI |