EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2S |
| Net Charge | 0 |
| Average Mass | 133.172 |
| Monoisotopic Mass | 133.01975 |
| SMILES | O=C(O)[C@@H]1CSCN1 |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | DZLNHFMRPBPULJ-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. hepatoprotective agent Any compound that is able to prevent damage to the liver. antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thioproline (CHEBI:45171) has role geroprotector (CHEBI:176497) |
| L-thioproline (CHEBI:45171) has role metabolite (CHEBI:25212) |
| L-thioproline (CHEBI:45171) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| L-thioproline (CHEBI:45171) is a thioproline (CHEBI:64564) |
| Incoming Relation(s) |
| 2-sulfomethyl-L-thioproline (CHEBI:73964) has functional parent L-thioproline (CHEBI:45171) |
| IUPAC Name |
|---|
| (4R)-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| (4R)-4-Thiazolidinecarboxylic acid | ChemIDplus |
| 4-thiaproline | ChEBI |
| L-Thiazolidine-4-carboxylic acid | ChemIDplus |
| (R)-(-)-4-Thiazolidinecarboxylic acid | ChemIDplus |
| (R)-4-Thiazolidinecarboxylic acid | ChemIDplus |
| L-thiaproline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1571 | MetaCyc |
| PRS | PDBeChem |
| US2008214648 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81065 | Reaxys |
| CAS:34592-47-7 | ChemIDplus |
| Citations |
|---|