EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O2 |
| Net Charge | 0 |
| Average Mass | 283.331 |
| Monoisotopic Mass | 283.13208 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1cnc3ccccc13)NC2=O |
| InChI | InChI=1S/C16H17N3O2/c20-15-14-6-3-7-19(14)16(21)13(18-15)8-10-9-17-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17H,3,6-8H2,(H,18,20)/t13-,14-/m0/s1 |
| InChIKey | RYFZBPVMVYTEKZ-KBPBESRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brevianamide F (CHEBI:64530) has role metabolite (CHEBI:25212) |
| brevianamide F (CHEBI:64530) is a dipeptide (CHEBI:46761) |
| brevianamide F (CHEBI:64530) is a indoles (CHEBI:24828) |
| brevianamide F (CHEBI:64530) is a pyrrolopyrazine (CHEBI:48337) |
| Incoming Relation(s) |
| 18-oxotryprostatin A (CHEBI:66842) has functional parent brevianamide F (CHEBI:64530) |
| 6-hydroxytryprostatin B (CHEBI:72762) has functional parent brevianamide F (CHEBI:64530) |
| deoxybrevianamide E (CHEBI:72948) has functional parent brevianamide F (CHEBI:64530) |
| tryprostatin A (CHEBI:72761) has functional parent brevianamide F (CHEBI:64530) |
| tryprostatin B (CHEBI:72760) has functional parent brevianamide F (CHEBI:64530) |
| IUPAC Name |
|---|
| (3S,8aS)-3-(1H-indol-3-ylmethyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonyms | Source |
|---|---|
| cyclo-L-Trp-L-Pro | ChEBI |
| cyclo-L-tryptophanyl-L-proline | ChEBI |
| cyclo-(Trp-Pro) | ChEBI |
| L-prolyl-L-tryptophan anhydride | ChEBI |
| L-tryptophyl-L-proline cyclic anhydride | ChEBI |
| tryptophan-proline diketopiperazine | ChEBI |
| UniProt Name | Source |
|---|---|
| brevianamide F | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:625131 | Reaxys |
| CAS:38136-70-8 | ChemIDplus |
| Citations |
|---|