EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N3O3 |
| Net Charge | 0 |
| Average Mass | 367.449 |
| Monoisotopic Mass | 367.18959 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1c(CC=C(C)C)nc3cc(O)ccc13)NC2=O |
| InChI | InChI=1S/C21H25N3O3/c1-12(2)5-8-16-15(14-7-6-13(25)10-17(14)22-16)11-18-21(27)24-9-3-4-19(24)20(26)23-18/h5-7,10,18-19,22,25H,3-4,8-9,11H2,1-2H3,(H,23,26)/t18-,19-/m0/s1 |
| InChIKey | CBQDILZSSFDSDL-OALUTQOASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxytryprostatin B (CHEBI:72762) has functional parent brevianamide F (CHEBI:64530) |
| 6-hydroxytryprostatin B (CHEBI:72762) is a dipeptide (CHEBI:46761) |
| 6-hydroxytryprostatin B (CHEBI:72762) is a indole alkaloid (CHEBI:38958) |
| 6-hydroxytryprostatin B (CHEBI:72762) is a indoles (CHEBI:24828) |
| 6-hydroxytryprostatin B (CHEBI:72762) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-{[6-hydroxy-2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonym | Source |
|---|---|
| desmethyltryprostatin A | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 6-hydroxytryprostatin B | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22406518 | Reaxys |
| Citations |
|---|