EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N3O3 |
| Net Charge | 0 |
| Average Mass | 381.476 |
| Monoisotopic Mass | 381.20524 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1c(CC=C(C)C)nc3cc(OC)ccc13)NC2=O |
| InChI | InChI=1S/C22H27N3O3/c1-13(2)6-9-17-16(15-8-7-14(28-3)11-18(15)23-17)12-19-22(27)25-10-4-5-20(25)21(26)24-19/h6-8,11,19-20,23H,4-5,9-10,12H2,1-3H3,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | XNRPVPHNDQHWLJ-PMACEKPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | breast cancer resistance protein inhibitor Any inhibitor of breast cancer resistance protein (ABCG2). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryprostatin A (CHEBI:72761) has functional parent brevianamide F (CHEBI:64530) |
| tryprostatin A (CHEBI:72761) has role breast cancer resistance protein inhibitor (CHEBI:72771) |
| tryprostatin A (CHEBI:72761) is a aromatic ether (CHEBI:35618) |
| tryprostatin A (CHEBI:72761) is a dipeptide (CHEBI:46761) |
| tryprostatin A (CHEBI:72761) is a indole alkaloid (CHEBI:38958) |
| tryprostatin A (CHEBI:72761) is a indoles (CHEBI:24828) |
| tryprostatin A (CHEBI:72761) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-{[6-methoxy-2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| UniProt Name | Source |
|---|---|
| tryprostatin A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| EP1464336 | Patent |
| WO2004087162 | Patent |
| Citations |
|---|