EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O4 |
| Net Charge | 0 |
| Average Mass | 395.459 |
| Monoisotopic Mass | 395.18451 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]([H])(Cc1c(C(=O)C=C(C)C)nc3cc(OC)ccc13)NC2=O |
| InChI | InChI=1S/C22H25N3O4/c1-12(2)9-19(26)20-15(14-7-6-13(29-3)10-16(14)23-20)11-17-22(28)25-8-4-5-18(25)21(27)24-17/h6-7,9-10,17-18,23H,4-5,8,11H2,1-3H3,(H,24,27)/t17-,18-/m0/s1 |
| InChIKey | UJAJXFUZWQQKAG-ROUUACIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (18505285) | Strain: PFW 1-13 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-oxotryprostatin A (CHEBI:66842) has functional parent brevianamide F (CHEBI:64530) |
| 18-oxotryprostatin A (CHEBI:66842) has role Aspergillus metabolite (CHEBI:76956) |
| 18-oxotryprostatin A (CHEBI:66842) has role antineoplastic agent (CHEBI:35610) |
| 18-oxotryprostatin A (CHEBI:66842) is a aromatic ether (CHEBI:35618) |
| 18-oxotryprostatin A (CHEBI:66842) is a aromatic ketone (CHEBI:76224) |
| 18-oxotryprostatin A (CHEBI:66842) is a dipeptide (CHEBI:46761) |
| 18-oxotryprostatin A (CHEBI:66842) is a enone (CHEBI:51689) |
| 18-oxotryprostatin A (CHEBI:66842) is a indole alkaloid (CHEBI:38958) |
| 18-oxotryprostatin A (CHEBI:66842) is a indoles (CHEBI:24828) |
| 18-oxotryprostatin A (CHEBI:66842) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-{[6-methoxy-2-(3-methylbut-2-enoyl)-1H-indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18842461 | Reaxys |
| Citations |
|---|