EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N3O2 |
| Net Charge | 0 |
| Average Mass | 351.450 |
| Monoisotopic Mass | 351.19468 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1c(C(C)(C)C=C)nc3ccccc13)NC2=O |
| InChI | InChI=1S/C21H25N3O2/c1-4-21(2,3)18-14(13-8-5-6-9-15(13)22-18)12-16-20(26)24-11-7-10-17(24)19(25)23-16/h4-6,8-9,16-17,22H,1,7,10-12H2,2-3H3,(H,23,25)/t16-,17-/m0/s1 |
| InChIKey | KUGNSEAHJVSMAJ-IRXDYDNUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxybrevianamide E (CHEBI:72948) has functional parent brevianamide F (CHEBI:64530) |
| deoxybrevianamide E (CHEBI:72948) is a dipeptide (CHEBI:46761) |
| deoxybrevianamide E (CHEBI:72948) is a indole alkaloid (CHEBI:38958) |
| deoxybrevianamide E (CHEBI:72948) is a indoles (CHEBI:24828) |
| deoxybrevianamide E (CHEBI:72948) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-{[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonyms | Source |
|---|---|
| cyclo-2-(1,1-dimethylallyl)-L-tryptophyl-L-proline | ChEBI |
| cyclo-L-prolyl-2-(1,1-dimethylallyl)-L-tryptophan | ChEBI |
| L-prolyl-2-(1,1-dimethylallyl)-L-tryptophan anhydride | ChEBI |
| UniProt Name | Source |
|---|---|
| deoxybrevianamide E | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:630815 | Reaxys |
| CAS:34610-68-9 | ChemIDplus |
| Citations |
|---|