EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:57930 - nucleoside 5'-diphosphate(3−)
| Formula | C5H8O10P2R |
| Net Charge | -3 |
| Average Mass (excl. R groups) | 290.059 |
| Monoisotopic Mass (excl. R groups) | 289.95927 |
| SMILES | *[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nucleoside 5'-diphosphate(3−) (CHEBI:57930) is a organophosphate oxoanion (CHEBI:58945) |
| nucleoside 5'-diphosphate(3−) (CHEBI:57930) is conjugate base of nucleoside 5'-diphosphate (CHEBI:16862) |
| Incoming Relation(s) |
| N2-(1-hydroxy-2-oxoethyl)-GDP (CHEBI:141574) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| N2-(1-hydroxy-2-oxopropyl)-GDP(3−) (CHEBI:141573) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| N2,N2,N7-trimethylguanosine diphosphate (2−) (CHEBI:156463) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| N6-(dimethylallyl)adenosine 5'-diphosphate(3−) (CHEBI:73533) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| 8-oxo-GDP(3−) (CHEBI:143554) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| ADP(3−) (CHEBI:456216) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| CDP(3−) (CHEBI:58069) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| GDP(3−) (CHEBI:58189) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| IDP(3−) (CHEBI:58280) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| UDP(3−) (CHEBI:58223) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| nucleoside 5'-diphosphate (CHEBI:16862) is conjugate acid of nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| Synonyms | Source |
|---|---|
| NDP(3−) | ChEBI |
| NDP trianion | ChEBI |
| nucleoside diphosphate trianion | ChEBI |
| ribonucleoside diphosphate(3−) | ChEBI |
| ribonucleoside diphosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| a ribonucleoside 5'-diphosphate | UniProt |