EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O11P2 |
| Net Charge | -3 |
| Average Mass | 425.163 |
| Monoisotopic Mass | 424.99160 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N4O11P2/c15-6-4(1-23-27(21,22)25-26(18,19)20)24-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,21,22)(H,11,12,17)(H2,18,19,20)/p-3/t4-,6-,7-,10-/m1/s1 |
| InChIKey | JPXZQMKKFWMMGK-KQYNXXCUSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IDP(3−) (CHEBI:58280) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| IDP(3−) (CHEBI:58280) has role human metabolite (CHEBI:77746) |
| IDP(3−) (CHEBI:58280) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| IDP(3−) (CHEBI:58280) is conjugate base of IDP (CHEBI:17808) |
| Incoming Relation(s) |
| IDP (CHEBI:17808) is conjugate acid of IDP(3−) (CHEBI:58280) |
| IUPAC Name |
|---|
| inosine 5'-diphosphate |
| Synonyms | Source |
|---|---|
| 5'-OO-[(phosphonatooxy)phosphinato]inosine | ChEBI |
| IDP trianion | ChEBI |
| inosine 5'-diphosphate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| IDP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5786306 | Beilstein |