EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N5O10P2 |
| Net Charge | -3 |
| Average Mass | 492.298 |
| Monoisotopic Mass | 492.07019 |
| SMILES | CC(C)=CCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23N5O10P2/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(22)11(21)9(29-15)5-28-32(26,27)30-31(23,24)25/h3,6-7,9,11-12,15,21-22H,4-5H2,1-2H3,(H,26,27)(H,16,17,18)(H2,23,24,25)/p-3/t9-,11-,12-,15-/m1/s1 |
| InChIKey | VXMXKDAHJURHEN-SDBHATRESA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(dimethylallyl)adenosine 5'-diphosphate(3−) (CHEBI:73533) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| N6-(dimethylallyl)adenosine 5'-diphosphate(3−) (CHEBI:73533) is conjugate base of N6-(dimethylallyl)adenosine 5'-diphosphate (CHEBI:71678) |
| Incoming Relation(s) |
| N6-(dimethylallyl)adenosine 5'-diphosphate (CHEBI:71678) is conjugate acid of N6-(dimethylallyl)adenosine 5'-diphosphate(3−) (CHEBI:73533) |
| IUPAC Name |
|---|
| N-(3-methylbut-2-en-1-yl)-5'-O-[(phosphonatooxy)phosphinato]adenosine |
| Synonyms | Source |
|---|---|
| N6-isopentenyladenosine 5'-diphosphate(3−) | ChEBI |
| isopentenyladenosine-5'-diphosphate(3−) | ChEBI |
| isopentenyladenosine riboside-5'-diphosphate(3−) | ChEBI |
| isopentenyl-ADP(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| N6-(dimethylallyl)adenosine 5'-diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-4203 | MetaCyc |