EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N3O11P2 |
| Net Charge | -3 |
| Average Mass | 400.153 |
| Monoisotopic Mass | 399.99635 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H15N3O11P2/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H2,10,11,15)(H2,16,17,18)/p-3/t4-,6-,7-,8-/m1/s1 |
| InChIKey | ZWIADYZPOWUWEW-XVFCMESISA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP(3−) (CHEBI:58069) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| CDP(3−) (CHEBI:58069) has role human metabolite (CHEBI:77746) |
| CDP(3−) (CHEBI:58069) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| CDP(3−) (CHEBI:58069) is conjugate base of CDP (CHEBI:17239) |
| Incoming Relation(s) |
| N5-(cytidine 5'-diphosphoramidyl)-L-glutamine(2−) (CHEBI:141583) has functional parent CDP(3−) (CHEBI:58069) |
| cytidine 3'-phospho-5'-diphosphoramidate(4−) (CHEBI:141584) has functional parent CDP(3−) (CHEBI:58069) |
| cytidine 5'-diphosphoramidate(2−) (CHEBI:141582) has functional parent CDP(3−) (CHEBI:58069) |
| CDP (CHEBI:17239) is conjugate acid of CDP(3−) (CHEBI:58069) |
| IUPAC Name |
|---|
| 5'-O-[(phosphonatooxy)phosphinato]cytidine |
| Synonyms | Source |
|---|---|
| CDP trianion | ChEBI |
| cytidine 5'-diphosphate | ChEBI |
| cytidine 5'-diphosphate(2−) | ChEBI |
| cytidine 5'-pyrophosphate | ChEBI |
| cytidine 5'-pyrophosphate(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| CDP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4047405 | Reaxys |
| Citations |
|---|