EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O11P2 |
| Net Charge | -3 |
| Average Mass | 440.178 |
| Monoisotopic Mass | 440.00250 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H15N5O11P2/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(25-9)1-24-28(22,23)26-27(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H2,19,20,21)(H3,11,13,14,18)/p-3/t3-,5-,6-,9-/m1/s1 |
| InChIKey | QGWNDRXFNXRZMB-UUOKFMHZSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP(3−) (CHEBI:58189) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| GDP(3−) (CHEBI:58189) has role human metabolite (CHEBI:77746) |
| GDP(3−) (CHEBI:58189) is a nucleoside 5'-diphosphate(3−) (CHEBI:57930) |
| GDP(3−) (CHEBI:58189) is conjugate base of GDP(2−) (CHEBI:65180) |
| Incoming Relation(s) |
| N2-(1-hydroxy-2-oxoethyl)-GDP (CHEBI:141574) has functional parent GDP(3−) (CHEBI:58189) |
| N2-(1-hydroxy-2-oxopropyl)-GDP(3−) (CHEBI:141573) has functional parent GDP(3−) (CHEBI:58189) |
| N2,N2,N7-trimethylguanosine diphosphate (2−) (CHEBI:156463) has functional parent GDP(3−) (CHEBI:58189) |
| N2-(ADP-D-ribosyl)-GDP(5−) (CHEBI:142713) has functional parent GDP(3−) (CHEBI:58189) |
| GDP(2−) (CHEBI:65180) is conjugate acid of GDP(3−) (CHEBI:58189) |
| IUPAC Name |
|---|
| 5'-O-[(phosphonatooxy)phosphinato]guanosine |
| Synonyms | Source |
|---|---|
| GDP trianion | ChEBI |
| guanosine 5'-diphosphate | ChEBI |
| guanosine 5'-diphosphate(3−) | ChEBI |
| guanosine 5'-diphosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| GDP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4896956 | Reaxys |
| Citations |
|---|