EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O2S |
| Net Charge | 0 |
| Average Mass | 229.305 |
| Monoisotopic Mass | 229.08850 |
| SMILES | Cn1cnc(S)c1C[C@@H](C(=O)[O-])[NH+](C)C |
| InChI | InChI=1S/C9H15N3O2S/c1-11(2)7(9(13)14)4-6-8(15)10-5-12(6)3/h5,7,15H,4H2,1-3H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | ONAWDGXCZMVYMN-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol C zwitterion (CHEBI:82725) has functional parent L-histidine zwitterion (CHEBI:57595) |
| ovothiol C zwitterion (CHEBI:82725) is a L-α-amino acid zwitterion (CHEBI:59869) |
| ovothiol C zwitterion (CHEBI:82725) is tautomer of ovothiol C (CHEBI:83415) |
| Incoming Relation(s) |
| ovothiol C (CHEBI:83415) is tautomer of ovothiol C zwitterion (CHEBI:82725) |
| IUPAC Name |
|---|
| (2S)-2-(dimethylazaniumyl)-3-(1-methyl-4-sulfanyl-1H-imidazol-5-yl)propanoate |
| Citations |
|---|