EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O2S |
| Net Charge | 0 |
| Average Mass | 215.278 |
| Monoisotopic Mass | 215.07285 |
| SMILES | C[NH2+][C@@H](Cc1c(S)ncn1C)C(=O)[O-] |
| InChI | InChI=1S/C8H13N3O2S/c1-9-5(8(12)13)3-6-7(14)10-4-11(6)2/h4-5,9,14H,3H2,1-2H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | VBMIRSPJYVMQOI-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol B zwitterion (CHEBI:82724) has functional parent L-histidine zwitterion (CHEBI:57595) |
| ovothiol B zwitterion (CHEBI:82724) is a L-α-amino acid zwitterion (CHEBI:59869) |
| ovothiol B zwitterion (CHEBI:82724) is tautomer of ovothiol B (CHEBI:83413) |
| Incoming Relation(s) |
| ovothiol B (CHEBI:83413) is tautomer of ovothiol B zwitterion (CHEBI:82724) |
| IUPAC Name |
|---|
| (2S)-2-(methylazaniumyl)-3-(1-methyl-4-sulfanyl-1H-imidazol-5-yl)propanoate |
| Citations |
|---|