EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2S |
| Net Charge | 0 |
| Average Mass | 201.251 |
| Monoisotopic Mass | 201.05720 |
| SMILES | Cn1cnc(S)c1C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H11N3O2S/c1-10-3-9-6(13)5(10)2-4(8)7(11)12/h3-4,13H,2,8H2,1H3,(H,11,12)/t4-/m0/s1 |
| InChIKey | XWKKYVJREGXHFO-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol A zwitterion (CHEBI:82723) has functional parent L-histidine zwitterion (CHEBI:57595) |
| ovothiol A zwitterion (CHEBI:82723) is a L-α-amino acid zwitterion (CHEBI:59869) |
| ovothiol A zwitterion (CHEBI:82723) is tautomer of ovothiol A (CHEBI:83318) |
| Incoming Relation(s) |
| ovothiol A (CHEBI:83318) is tautomer of ovothiol A zwitterion (CHEBI:82723) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(1-methyl-4-sulfanyl-1H-imidazol-5-yl)propanoate |
| Synonym | Source |
|---|---|
| N1-methyl-4-mercaptohistidine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| ovothiol A | UniProt |
| Citations |
|---|