EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO |
| Net Charge | 0 |
| Average Mass | 117.192 |
| Monoisotopic Mass | 117.11536 |
| SMILES | CCN(CC)CCO |
| InChI | InChI=1S/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
| InChIKey | BFSVOASYOCHEOV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | plastic light stabilizer a plastic additive that prevent degradation caused by light, heat, and UV from the sun polymerization initiator a substance that triggers polymerization process, leading to the formation of polymers from monomers Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | plastic light stabilizer a plastic additive that prevent degradation caused by light, heat, and UV from the sun polymerization initiator a substance that triggers polymerization process, leading to the formation of polymers from monomers |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-diethylaminoethanol (CHEBI:52153) has functional parent ethanolamine (CHEBI:16000) |
| 2-diethylaminoethanol (CHEBI:52153) has parent hydride triethylamine (CHEBI:35026) |
| 2-diethylaminoethanol (CHEBI:52153) has role plastic light stabilizer (CHEBI:747339) |
| 2-diethylaminoethanol (CHEBI:52153) has role polymerization initiator (CHEBI:747342) |
| 2-diethylaminoethanol (CHEBI:52153) is a ethanolamines (CHEBI:23981) |
| 2-diethylaminoethanol (CHEBI:52153) is a primary alcohol (CHEBI:15734) |
| 2-diethylaminoethanol (CHEBI:52153) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| chloroprocaine (CHEBI:3636) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| dicyclomine (CHEBI:4514) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| oxybuprocaine (CHEBI:309594) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| procaine (CHEBI:8430) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethanol |
| Synonyms | Source |
|---|---|
| DEAE | NIST Chemistry WebBook |
| Diethyl(2-hydroxyethyl)amine | ChemIDplus |
| Diethylaminoethanol | ChemIDplus |
| diethylethanolamine | ChemIDplus |
| diethylmonoethanolamine | ChemIDplus |
| N,N-diethyl-N-(β-hydroxyethyl)amine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2-Diethylaminoethanol | Wikipedia |
| HMDB0033971 | HMDB |
| Citations |
|---|