EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:309594 - oxybuprocaine
| Formula | C17H28N2O3 |
| Net Charge | 0 |
| Average Mass | 308.422 |
| Monoisotopic Mass | 308.20999 |
| SMILES | CCCCOc1cc(C(=O)OCCN(CC)CC)ccc1N |
| InChI | InChI=1S/C17H28N2O3/c1-4-7-11-21-16-13-14(8-9-15(16)18)17(20)22-12-10-19(5-2)6-3/h8-9,13H,4-7,10-12,18H2,1-3H3 |
| InChIKey | CMHHMUWAYWTMGS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. drug allergen Any drug which causes the onset of an allergic reaction. topical anaesthetic A local anesthetic that is used to numb the surface of a body part. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxybuprocaine (CHEBI:309594) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| oxybuprocaine (CHEBI:309594) has role drug allergen (CHEBI:88188) |
| oxybuprocaine (CHEBI:309594) has role local anaesthetic (CHEBI:36333) |
| oxybuprocaine (CHEBI:309594) has role topical anaesthetic (CHEBI:48425) |
| oxybuprocaine (CHEBI:309594) is a amino-acid ester (CHEBI:46668) |
| oxybuprocaine (CHEBI:309594) is a benzoate ester (CHEBI:36054) |
| oxybuprocaine (CHEBI:309594) is a substituted aniline (CHEBI:48975) |
| oxybuprocaine (CHEBI:309594) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| oxybuprocaine hydrochloride (CHEBI:31260) has part oxybuprocaine (CHEBI:309594) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate |
| INNs | Source |
|---|---|
| oxibuprocaina | ChemIDplus |
| oxybuprocaine | ChemIDplus |
| oxybuprocainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-3-butoxy-2-(diethylamino)ethyl ester benzoic acid | ChemIDplus |
| 4-Amino-3-butoxy-benzoic acid 2-diethylamino-ethyl ester | ChEMBL |
| 4-Amino-3-n-butoxy-benzoesäure-diäthylaminoäthylester | ChemIDplus |
| Benoxil | ChemIDplus |
| benoxinate | ChEMBL |
| Benoxinate | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 3016 | DrugCentral |
| D08319 | KEGG DRUG |
| DB00892 | DrugBank |
| GB654484 | Patent |
| HMDB0015029 | HMDB |
| LSM-2069 | LINCS |
| Oxybuprocaine | Wikipedia |
| Citations |
|---|