EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28N2O3 |
| Net Charge | 0 |
| Average Mass | 308.422 |
| Monoisotopic Mass | 308.20999 |
| SMILES | CCCCOc1cc(C(=O)OCCN(CC)CC)ccc1N |
| InChI | InChI=1S/C17H28N2O3/c1-4-7-11-21-16-13-14(8-9-15(16)18)17(20)22-12-10-19(5-2)6-3/h8-9,13H,4-7,10-12,18H2,1-3H3 |
| InChIKey | CMHHMUWAYWTMGS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. topical anaesthetic A local anesthetic that is used to numb the surface of a body part. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxybuprocaine (CHEBI:309594) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| oxybuprocaine (CHEBI:309594) has role drug allergen (CHEBI:88188) |
| oxybuprocaine (CHEBI:309594) has role local anaesthetic (CHEBI:36333) |
| oxybuprocaine (CHEBI:309594) has role topical anaesthetic (CHEBI:48425) |
| oxybuprocaine (CHEBI:309594) is a amino-acid ester (CHEBI:46668) |
| oxybuprocaine (CHEBI:309594) is a benzoate ester (CHEBI:36054) |
| oxybuprocaine (CHEBI:309594) is a substituted aniline (CHEBI:48975) |
| oxybuprocaine (CHEBI:309594) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| oxybuprocaine hydrochloride (CHEBI:31260) has part oxybuprocaine (CHEBI:309594) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate |
| INNs | Source |
|---|---|
| oxibuprocaina | ChemIDplus |
| oxybuprocaine | ChemIDplus |
| oxybuprocainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-3-butoxy-2-(diethylamino)ethyl ester benzoic acid | ChemIDplus |
| 4-Amino-3-butoxy-benzoic acid 2-diethylamino-ethyl ester | ChEMBL |
| 4-Amino-3-n-butoxy-benzoesäure-diäthylaminoäthylester | ChemIDplus |
| Benoxil | ChemIDplus |
| Benoxinate | DrugBank |
| BENOXINATE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3016 | DrugCentral |
| D08319 | KEGG DRUG |
| DB00892 | DrugBank |
| GB654484 | Patent |
| HMDB0015029 | HMDB |
| LSM-2069 | LINCS |
| Oxybuprocaine | Wikipedia |
| Citations |
|---|