EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8430 - procaine
| Formula | C13H20N2O2 |
| Net Charge | 0 |
| Average Mass | 236.315 |
| Monoisotopic Mass | 236.15248 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3 |
| InChIKey | MFDFERRIHVXMIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procaine (CHEBI:8430) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| procaine (CHEBI:8430) has functional parent 4-aminobenzoic acid (CHEBI:30753) |
| procaine (CHEBI:8430) has role central nervous system depressant (CHEBI:35488) |
| procaine (CHEBI:8430) has role drug allergen (CHEBI:88188) |
| procaine (CHEBI:8430) has role local anaesthetic (CHEBI:36333) |
| procaine (CHEBI:8430) has role peripheral nervous system drug (CHEBI:49110) |
| procaine (CHEBI:8430) is a benzoate ester (CHEBI:36054) |
| procaine (CHEBI:8430) is a substituted aniline (CHEBI:48975) |
| procaine (CHEBI:8430) is a tertiary amino compound (CHEBI:50996) |
| procaine (CHEBI:8430) is conjugate base of procaine(1+) (CHEBI:52160) |
| Incoming Relation(s) |
| procaine(1+) (CHEBI:52160) is conjugate acid of procaine (CHEBI:8430) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 4-aminobenzoate |
| INNs | Source |
|---|---|
| procaina | ChemIDplus |
| procaine | ChemIDplus |
| procainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Diethylaminoethyl p-aminobenzoate | ChemIDplus |
| 4-aminobenzoic acid 2-diethylaminoethyl ester | ChEBI |
| novocaine | ChEBI |
| p-Aminobenzoic acid 2-diethylaminoethyl ester | ChemIDplus |
| Procaine | KEGG COMPOUND |
| Vitamin H3 | ChemIDplus |
| Citations |
|---|