EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8430 - procaine
| Formula | C13H20N2O2 |
| Net Charge | 0 |
| Average Mass | 236.315 |
| Monoisotopic Mass | 236.15248 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3 |
| InChIKey | MFDFERRIHVXMIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. drug allergen Any drug which causes the onset of an allergic reaction. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procaine (CHEBI:8430) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| procaine (CHEBI:8430) has functional parent 4-aminobenzoic acid (CHEBI:30753) |
| procaine (CHEBI:8430) has role central nervous system depressant (CHEBI:35488) |
| procaine (CHEBI:8430) has role drug allergen (CHEBI:88188) |
| procaine (CHEBI:8430) has role local anaesthetic (CHEBI:36333) |
| procaine (CHEBI:8430) has role peripheral nervous system drug (CHEBI:49110) |
| procaine (CHEBI:8430) is a benzoate ester (CHEBI:36054) |
| procaine (CHEBI:8430) is a substituted aniline (CHEBI:48975) |
| procaine (CHEBI:8430) is a tertiary amino compound (CHEBI:50996) |
| procaine (CHEBI:8430) is conjugate base of procaine(1+) (CHEBI:52160) |
| Incoming Relation(s) |
| procaine(1+) (CHEBI:52160) is conjugate acid of procaine (CHEBI:8430) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 4-aminobenzoate |
| INNs | Source |
|---|---|
| procaine | ChemIDplus |
| procaina | ChemIDplus |
| procainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Procaine | KEGG COMPOUND |
| p-Aminobenzoic acid 2-diethylaminoethyl ester | ChemIDplus |
| 2-Diethylaminoethyl p-aminobenzoate | ChemIDplus |
| Vitamin H3 | ChemIDplus |
| β-(diethylamino)ethyl p-aminobenzoate | NIST Chemistry WebBook |
| β-(diethylamino)ethyl 4-aminobenzoate | NIST Chemistry WebBook |
| Citations |
|---|