EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19ClN2O2 |
| Net Charge | 0 |
| Average Mass | 270.760 |
| Monoisotopic Mass | 270.11351 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O2/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14/h5-6,9H,3-4,7-8,15H2,1-2H3 |
| InChIKey | VDANGULDQQJODZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroprocaine (CHEBI:3636) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| chloroprocaine (CHEBI:3636) has functional parent 4-amino-2-chlorobenzoic acid (CHEBI:59472) |
| chloroprocaine (CHEBI:3636) has role central nervous system depressant (CHEBI:35488) |
| chloroprocaine (CHEBI:3636) has role local anaesthetic (CHEBI:36333) |
| chloroprocaine (CHEBI:3636) has role peripheral nervous system drug (CHEBI:49110) |
| chloroprocaine (CHEBI:3636) is a benzoate ester (CHEBI:36054) |
| chloroprocaine (CHEBI:3636) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| chloroprocaine hydrochloride (CHEBI:3637) has part chloroprocaine (CHEBI:3636) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate |
| INNs | Source |
|---|---|
| chloroprocainum | ChemIDplus |
| chloroprocaine | ChemIDplus |
| cloroprocaina | ChemIDplus |
| Synonyms | Source |
|---|---|
| Chloroprocaine | KEGG COMPOUND |
| 2-chloroprocaine | ChemIDplus |
| 4-amino-2-chlorobenzoic acid 2-(diethylamino)ethyl ester | ChEBI |
| chloroprocain | DrugBank |