EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4514 - dicyclomine
| Formula | C19H35NO2 |
| Net Charge | 0 |
| Average Mass | 309.494 |
| Monoisotopic Mass | 309.26678 |
| SMILES | CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3 |
| InChIKey | CURUTKGFNZGFSE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicyclomine (CHEBI:4514) has functional parent 1,1'-bi(cyclohexyl)-1-carboxylic acid (CHEBI:59738) |
| dicyclomine (CHEBI:4514) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| dicyclomine (CHEBI:4514) has role antispasmodic drug (CHEBI:53784) |
| dicyclomine (CHEBI:4514) has role muscarinic antagonist (CHEBI:48876) |
| dicyclomine (CHEBI:4514) has role parasympatholytic (CHEBI:50370) |
| dicyclomine (CHEBI:4514) is a carboxylic ester (CHEBI:33308) |
| dicyclomine (CHEBI:4514) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| dicyclomine hydrochloride (CHEBI:4515) has part dicyclomine (CHEBI:4514) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 1,1'-bi(cyclohexyl)-1-carboxylate |
| INNs | Source |
|---|---|
| dicicloverina | ChemIDplus |
| dicycloverinum | ChemIDplus |
| dicycloverine | ChEBI |
| dicycloverine | ChEBI |
| Synonyms | Source |
|---|---|
| Dicyclomine | KEGG COMPOUND |
| Bicyclohexyl-1-carboxylic acid 2-diethylamino-ethyl ester | ChEMBL |
| 2-(diethylamino)ethyl 1-cyclohexylcyclohexanecarboxylate | ChEMBL |
| DICYCLOMINE | ChEMBL |
| Dicycloverin | KEGG COMPOUND |