EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4514 - dicyclomine
| Formula | C19H35NO2 |
| Net Charge | 0 |
| Average Mass | 309.494 |
| Monoisotopic Mass | 309.26678 |
| SMILES | CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3 |
| InChIKey | CURUTKGFNZGFSE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicyclomine (CHEBI:4514) has functional parent 1,1'-bi(cyclohexyl)-1-carboxylic acid (CHEBI:59738) |
| dicyclomine (CHEBI:4514) has functional parent 2-diethylaminoethanol (CHEBI:52153) |
| dicyclomine (CHEBI:4514) has role antispasmodic drug (CHEBI:53784) |
| dicyclomine (CHEBI:4514) has role muscarinic antagonist (CHEBI:48876) |
| dicyclomine (CHEBI:4514) has role parasympatholytic (CHEBI:50370) |
| dicyclomine (CHEBI:4514) is a carboxylic ester (CHEBI:33308) |
| dicyclomine (CHEBI:4514) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| dicyclomine hydrochloride (CHEBI:4515) has part dicyclomine (CHEBI:4514) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 1,1'-bi(cyclohexyl)-1-carboxylate |
| INNs | Source |
|---|---|
| dicicloverina | ChemIDplus |
| dicycloverine | ChEBI |
| dicycloverine | ChEBI |
| dicycloverinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(diethylamino)ethyl 1-cyclohexylcyclohexanecarboxylate | ChEMBL |
| Bicyclohexyl-1-carboxylic acid 2-diethylamino-ethyl ester | ChEMBL |
| Dicyclomine | KEGG COMPOUND |
| DICYCLOMINE | ChEMBL |
| Dicycloverin | KEGG COMPOUND |