EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)C1CCC(C)C(O)C1 |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3 |
| InChIKey | KRCZYMFUWVJCLI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrocarveol (CHEBI:50215) has functional parent carveol (CHEBI:23046) |
| dihydrocarveol (CHEBI:50215) has role acaricide (CHEBI:22153) |
| dihydrocarveol (CHEBI:50215) has role plant metabolite (CHEBI:76924) |
| dihydrocarveol (CHEBI:50215) has role volatile oil component (CHEBI:27311) |
| dihydrocarveol (CHEBI:50215) is a p-menthane monoterpenoid (CHEBI:25186) |
| dihydrocarveol (CHEBI:50215) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| (+)-dihydrocarveol (CHEBI:50235) is a dihydrocarveol (CHEBI:50215) |
| (+)-isodihydrocarveol (CHEBI:50233) is a dihydrocarveol (CHEBI:50215) |
| (+)-neodihydrocarveol (CHEBI:152) is a dihydrocarveol (CHEBI:50215) |
| (+)-neoisodihydrocarveol (CHEBI:50232) is a dihydrocarveol (CHEBI:50215) |
| (−)-dihydrocarveol (CHEBI:149) is a dihydrocarveol (CHEBI:50215) |
| (−)-isodihydrocarveol (CHEBI:150) is a dihydrocarveol (CHEBI:50215) |
| (−)-neodihydrocarveol (CHEBI:158) is a dihydrocarveol (CHEBI:50215) |
| (−)-neoisodihydrocarveol (CHEBI:153) is a dihydrocarveol (CHEBI:50215) |
| IUPAC Names |
|---|
| 2-methyl-5-(prop-1-en-2-yl)cyclohexanol |
| p-menth-8-en-2-ol |
| Synonyms | Source |
|---|---|
| 1,6-Dihydrocarveol | KEGG COMPOUND |
| 1,6-Dihydrocarveol | ChemIDplus |
| 2-Methyl-5-(1-methylethenyl)cyclohexanol | ChemIDplus |
| 2-methyl-5-isopropenylcyclohexanol | ChEBI |
| 5-isopropenyl-2-methylcyclohexanol | ChEBI |
| 6-Methyl-3-isopropenylcyclohexanol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| dihydrocarveol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C18017 | KEGG COMPOUND |
| Dihydrocarveols | MetaCyc |
| Citations |
|---|