EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)[C@H]1CC[C@@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | KRCZYMFUWVJCLI-KXUCPTDWSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-isodihydrocarveol (CHEBI:150) is a dihydrocarveol (CHEBI:50215) |
| (−)-isodihydrocarveol (CHEBI:150) is enantiomer of (+)-isodihydrocarveol (CHEBI:50233) |
| Incoming Relation(s) |
| (+)-isodihydrocarveol (CHEBI:50233) is enantiomer of (−)-isodihydrocarveol (CHEBI:150) |
| IUPAC Names |
|---|
| (1R,2R,4S)-p-menth-8-en-2-ol |
| (1R,2R,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohexanol |
| Synonyms | Source |
|---|---|
| (1R,2R,5S)-5-isopropenyl-2-methylcyclohexanol | ChEBI |
| (1R,2R,4S)-Iso-dihydrocarveol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1R,2R,4S)-isodihydrocarveol | UniProt |
| Citations |
|---|