EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | KRCZYMFUWVJCLI-OPRDCNLKSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-dihydrocarveol (CHEBI:149) has role fragrance (CHEBI:48318) |
| (−)-dihydrocarveol (CHEBI:149) is a dihydrocarveol (CHEBI:50215) |
| (−)-dihydrocarveol (CHEBI:149) is enantiomer of (+)-dihydrocarveol (CHEBI:50235) |
| Incoming Relation(s) |
| (+)-dihydrocarveol (CHEBI:50235) is enantiomer of (−)-dihydrocarveol (CHEBI:149) |
| IUPAC Names |
|---|
| (1R,2R,4R)-p-menth-8-en-2-ol |
| (1R,2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanol |
| Synonyms | Source |
|---|---|
| (1R,2R,5R)-5-isopropenyl-2-methylcyclohexanol | ChEBI |
| (1R,2R,4R)-Dihydrocarveol | KEGG COMPOUND |
| (-)-Dihydrocarveol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1R,2R,4R)-dihydrocarveol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00010937 | KNApSAcK |
| C11396 | KEGG COMPOUND |
| CPD-10027 | MetaCyc |
| HMDB0035825 | HMDB |
| LMPR0102090031 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2325090 | Reaxys |
| CAS:20549-47-7 | ChemIDplus |
| CAS:20549-47-7 | KEGG COMPOUND |
| Citations |
|---|