EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)[C@H]1CC[C@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10+/m0/s1 |
| InChIKey | KRCZYMFUWVJCLI-LPEHRKFASA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-neodihydrocarveol (CHEBI:158) has role fungal xenobiotic metabolite (CHEBI:76968) |
| (−)-neodihydrocarveol (CHEBI:158) is a dihydrocarveol (CHEBI:50215) |
| (−)-neodihydrocarveol (CHEBI:158) is enantiomer of (+)-neodihydrocarveol (CHEBI:152) |
| Incoming Relation(s) |
| (+)-neodihydrocarveol (CHEBI:152) is enantiomer of (−)-neodihydrocarveol (CHEBI:158) |
| IUPAC Names |
|---|
| (1R,2S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohexanol |
| (1S,2R,4S)-p-menth-8-en-2-ol |
| Synonyms | Source |
|---|---|
| (1R,2S,5S)-5-isopropenyl-2-methylcyclohexanol | ChEBI |
| (1S,2R,4S)-Neo-dihydrocarveol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,2R,4S)-neodihydrocarveol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11416 | KEGG COMPOUND |
| CPD-10034 | MetaCyc |
| LMPR0102090040 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2325091 | Reaxys |
| Citations |
|---|