EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)C1CC=C(C)C(O)C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3 |
| InChIKey | BAVONGHXFVOKBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carveol (CHEBI:23046) has role plant metabolite (CHEBI:76924) |
| carveol (CHEBI:23046) has role volatile oil component (CHEBI:27311) |
| carveol (CHEBI:23046) is a limonene monoterpenoid (CHEBI:25040) |
| Incoming Relation(s) |
| dihydrocarveol (CHEBI:50215) has functional parent carveol (CHEBI:23046) |
| (+)-cis-carveol (CHEBI:232) is a carveol (CHEBI:23046) |
| (+)-trans-carveol (CHEBI:15388) is a carveol (CHEBI:23046) |
| (−)-cis-carveol (CHEBI:227) is a carveol (CHEBI:23046) |
| (−)-trans-carveol (CHEBI:15389) is a carveol (CHEBI:23046) |
| IUPAC Name |
|---|
| 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| Synonyms | Source |
|---|---|
| 5-Isopropenyl-2-methyl-2-cyclohexen-1-ol | ChemIDplus |
| p-Mentha-1,8-dien-6-ol | ChemIDplus |
| p-Mentha-6,8-dien-2-ol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1861032 | Reaxys |
| CAS:99-48-9 | ChemIDplus |
| Citations |
|---|