EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4O2 |
| Net Charge | 0 |
| Average Mass | 152.113 |
| Monoisotopic Mass | 152.03343 |
| SMILES | O=c1nc(=O)c2ncnc2n1 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7H-xanthine (CHEBI:48517) is a xanthine (CHEBI:15318) |
| 7H-xanthine (CHEBI:48517) is tautomer of 9H-xanthine (CHEBI:17712) |
| Incoming Relation(s) |
| 1-methyl-7H-xanthine (CHEBI:68444) has functional parent 7H-xanthine (CHEBI:48517) |
| 3-isobutyl-1-methyl-7H-xanthine (CHEBI:34795) has functional parent 7H-xanthine (CHEBI:48517) |
| 7-methylxanthine (CHEBI:48991) has functional parent 7H-xanthine (CHEBI:48517) |
| doxofylline (CHEBI:94714) has functional parent 7H-xanthine (CHEBI:48517) |
| DPCPX (CHEBI:73282) has functional parent 7H-xanthine (CHEBI:48517) |
| linagliptin (CHEBI:68610) has functional parent 7H-xanthine (CHEBI:48517) |
| 9H-xanthine (CHEBI:17712) is tautomer of 7H-xanthine (CHEBI:48517) |
| IUPAC Name |
|---|
| 3,7-dihydro-1H-purine-2,6-dione |
| Synonym | Source |
|---|---|
| Xanthine | KEGG COMPOUND |
| Citations |
|---|