EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N4O2 |
| Net Charge | 0 |
| Average Mass | 304.394 |
| Monoisotopic Mass | 304.18993 |
| SMILES | CCCn1c(=O)c2nc(C3CCCC3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C16H24N4O2/c1-3-9-19-14-12(15(21)20(10-4-2)16(19)22)17-13(18-14)11-7-5-6-8-11/h11H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | FFBDFADSZUINTG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | adenosine A1 receptor antagonist An antagonist at the A1 receptor. EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DPCPX (CHEBI:73282) has functional parent 7H-xanthine (CHEBI:48517) |
| DPCPX (CHEBI:73282) has role adenosine A1 receptor antagonist (CHEBI:63957) |
| DPCPX (CHEBI:73282) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| DPCPX (CHEBI:73282) is a oxopurine (CHEBI:25810) |
| IUPAC Name |
|---|
| 8-cyclopentyl-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,3-Dipropyl-8-cyclopentylxanthine | ChemIDplus |
| 1,3-Dpcpx | ChemIDplus |
| 8-Cyclopentyl-1,3-dipropylxanthine | KEGG COMPOUND |
| CPX | KEGG COMPOUND |
| dipropylcyclopentylxanthine | ChEBI |
| PD-116,948 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C13709 | KEGG COMPOUND |
| Dipropylcyclopentylxanthine | Wikipedia |
| LSM-19971 | LINCS |
| US2004259889 | Patent |
| US5470579 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4298634 | Reaxys |
| CAS:102146-07-6 | KEGG COMPOUND |
| CAS:102146-07-6 | ChemIDplus |
| Citations |
|---|