EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N4O4 |
| Net Charge | 0 |
| Average Mass | 266.257 |
| Monoisotopic Mass | 266.10150 |
| SMILES | Cn1c(=O)c2c(ncn2CC2OCCO2)n(C)c1=O |
| InChI | InChI=1S/C11H14N4O4/c1-13-9-8(10(16)14(2)11(13)17)15(6-12-9)5-7-18-3-4-19-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | HWXIGFIVGWUZAO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxofylline (CHEBI:94714) has functional parent 7H-xanthine (CHEBI:48517) |
| doxofylline (CHEBI:94714) has role anti-asthmatic drug (CHEBI:49167) |
| doxofylline (CHEBI:94714) has role antitussive (CHEBI:51177) |
| doxofylline (CHEBI:94714) has role bronchodilator agent (CHEBI:35523) |
| doxofylline (CHEBI:94714) is a oxopurine (CHEBI:25810) |
| IUPAC Name |
|---|
| 7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| INNs | Source |
|---|---|
| doxofilina | ChemIDplus |
| doxofylline | ChemIDplus |
| doxofyllinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| ansimar | DrugCentral |
| dioxyfilline | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 959 | DrugCentral |
| D03898 | KEGG DRUG |
| DB09273 | DrugBank |
| Doxofylline | Wikipedia |
| LSM-5779 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:69975-86-6 | ChemIDplus |
| Citations |
|---|