EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N4O2 |
| Net Charge | 0 |
| Average Mass | 166.140 |
| Monoisotopic Mass | 166.04908 |
| SMILES | Cn1c(=O)nc2ncnc2c1=O |
| InChI | InChI=1S/C6H6N4O2/c1-10-5(11)3-4(8-2-7-3)9-6(10)12/h2H,1H3,(H,7,8)(H,9,12) |
| InChIKey | MVOYJPOZRLFTCP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyl-7H-xanthine (CHEBI:68444) has functional parent 7H-xanthine (CHEBI:48517) |
| 1-methyl-7H-xanthine (CHEBI:68444) has role mouse metabolite (CHEBI:75771) |
| 1-methyl-7H-xanthine (CHEBI:68444) is a 1-methylxanthine (CHEBI:68443) |
| Incoming Relation(s) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) has functional parent 1-methyl-7H-xanthine (CHEBI:68444) |
| IUPAC Name |
|---|
| 1-methyl-3,7-dihydro-1H-purine-2,6-dione |
| Manual Xrefs | Databases |
|---|---|
| C16358 | KEGG COMPOUND |
| CPD-9025 | MetaCyc |
| HMDB0010738 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:171507 | Reaxys |
| CAS:6136-37-4 | ChemIDplus |
| CAS:6136-37-4 | KEGG COMPOUND |
| Citations |
|---|