EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N8O2 |
| Net Charge | 0 |
| Average Mass | 472.553 |
| Monoisotopic Mass | 472.23352 |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(Cc1nc(C)c3ccccc3n1)c(=O)n2C |
| InChI | InChI=1S/C25H28N8O2/c1-4-5-13-32-21-22(29-24(32)31-12-8-9-17(26)14-31)30(3)25(35)33(23(21)34)15-20-27-16(2)18-10-6-7-11-19(18)28-20/h6-7,10-11,17H,8-9,12-15,26H2,1-3H3/t17-/m1/s1 |
| InChIKey | LTXREWYXXSTFRX-QGZVFWFLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that specifically inhibits dipeptidyl peptidase-4 (EC 3.4.14.5). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linagliptin (CHEBI:68610) has functional parent 7H-xanthine (CHEBI:48517) |
| linagliptin (CHEBI:68610) has role EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor (CHEBI:68612) |
| linagliptin (CHEBI:68610) has role hypoglycemic agent (CHEBI:35526) |
| linagliptin (CHEBI:68610) is a aminopiperidine (CHEBI:48588) |
| linagliptin (CHEBI:68610) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 8-[(3R)-3-aminopiperidin-1-yl]-7-(but-2-yn-1-yl)-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione |
| INN | Source |
|---|---|
| linagliptin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (R)-8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-1-(4-methylquinazolin-2-ylmethyl)-3,7-dihydro-purine-2,6-dione | ChemIDplus |
| BI 1356 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tradjenta | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09566 | KEGG DRUG |
| 356 | PDBeChem |
| WO2009022008 | Patent |
| EP246874 | Patent |
| US2012165525 | Patent |
| WO2006048427 | Patent |
| WO2004018468 | Patent |
| WO2010072776 | Patent |
| EP1852108 | Patent |
| US2007259900 | Patent |
| Linagliptin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11300181 | Reaxys |
| CAS:668270-12-0 | KEGG DRUG |
| CAS:668270-12-0 | ChemIDplus |
| Citations |
|---|