EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3N3O6 |
| Net Charge | 0 |
| Average Mass | 213.105 |
| Monoisotopic Mass | 213.00218 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H |
| InChIKey | UATJOMSPNYCXIX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,5-trinitrobenzene (CHEBI:48113) has role explosive (CHEBI:63490) |
| 1,3,5-trinitrobenzene (CHEBI:48113) is a trinitrobenzene (CHEBI:48110) |
| Incoming Relation(s) |
| 2,4,6-trinitrotoluene (CHEBI:46053) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| 2,4,6-trinitroxylene (CHEBI:77316) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| musk xylene (CHEBI:77320) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| picric acid (CHEBI:46149) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| IUPAC Name |
|---|
| 1,3,5-trinitrobenzene |
| Synonyms | Source |
|---|---|
| s-trinitrobenzene | NIST Chemistry WebBook |
| 1,3,5-Trinitrobenzol | ChEBI |
| sym-trinitrobenzene | ChemIDplus |
| TNB | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1,3,5-Trinitrobenzene | Wikipedia |