EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O6 |
| Net Charge | 0 |
| Average Mass | 297.267 |
| Monoisotopic Mass | 297.09609 |
| SMILES | Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O6/c1-6-9(13(16)17)7(2)11(15(20)21)8(12(3,4)5)10(6)14(18)19/h1-5H3 |
| InChIKey | XMWRWTSZNLOZFN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| musk xylene (CHEBI:77320) has functional parent m-xylene (CHEBI:28488) |
| musk xylene (CHEBI:77320) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| musk xylene (CHEBI:77320) has role carcinogenic agent (CHEBI:50903) |
| musk xylene (CHEBI:77320) has role explosive (CHEBI:63490) |
| musk xylene (CHEBI:77320) has role fragrance (CHEBI:48318) |
| musk xylene (CHEBI:77320) is a C-nitro compound (CHEBI:35716) |
| IUPAC Name |
|---|
| 1-tert-butyl-3,5-dimethyl-2,4,6-trinitrobenzene |
| Synonyms | Source |
|---|---|
| 1-(1,1-Dimethylethyl)-3,5-dimethyl-2,4,6-trinitrobenzene | ChemIDplus |
| 2,4,6-Trinitro-1,3-dimethyl-5-tert-butylbenzene | ChemIDplus |
| 2,4,6-Trinitro-3,5-dimethyl-1-tert-butylbenzene | ChemIDplus |
| 2,4,6-Trinitro-5-tert-butyl-m-xylene | ChemIDplus |
| 5-tert-Butyl-2,4,6-trinitroxylene | ChemIDplus |
| Xylene musk | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C19462 | KEGG COMPOUND |
| Musk_xylene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2015910 | Reaxys |
| CAS:81-15-2 | KEGG COMPOUND |
| CAS:81-15-2 | ChemIDplus |
| Citations |
|---|