EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N3O6 |
| Net Charge | 0 |
| Average Mass | 241.159 |
| Monoisotopic Mass | 241.03348 |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O6/c1-4-6(9(12)13)3-7(10(14)15)5(2)8(4)11(16)17/h3H,1-2H3 |
| InChIKey | GGGVOOMKPJYWDF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trinitroxylene (CHEBI:77316) has functional parent m-xylene (CHEBI:28488) |
| 2,4,6-trinitroxylene (CHEBI:77316) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| 2,4,6-trinitroxylene (CHEBI:77316) has role explosive (CHEBI:63490) |
| 2,4,6-trinitroxylene (CHEBI:77316) is a C-nitro compound (CHEBI:35716) |
| IUPAC Name |
|---|
| 2,4-dimethyl-1,3,5-trinitrobenzene |
| Synonym | Source |
|---|---|
| 2,4,6-Trinitro-m-xylene | ChemIDplus |