EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3N3O7 |
| Net Charge | 0 |
| Average Mass | 229.104 |
| Monoisotopic Mass | 228.99710 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H |
| InChIKey | OXNIZHLAWKMVMX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Biological Role: | fixative Any compound used for the purpose of preserving biological tissues from decay in such a way as to allow for the preparation of thin, stained sections for subsequent histological study. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picric acid (CHEBI:46149) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| picric acid (CHEBI:46149) has functional parent phenol (CHEBI:15882) |
| picric acid (CHEBI:46149) has role antiseptic drug (CHEBI:48218) |
| picric acid (CHEBI:46149) has role explosive (CHEBI:63490) |
| picric acid (CHEBI:46149) has role fixative (CHEBI:50913) |
| picric acid (CHEBI:46149) is a C-nitro compound (CHEBI:35716) |
| picric acid (CHEBI:46149) is conjugate acid of picrate anion (CHEBI:86297) |
| Incoming Relation(s) |
| TNP-ATP (CHEBI:50104) has functional parent picric acid (CHEBI:46149) |
| picrate anion (CHEBI:86297) is conjugate base of picric acid (CHEBI:46149) |
| IUPAC Name |
|---|
| 2,4,6-trinitrophenol |
| Synonyms | Source |
|---|---|
| 2-hydroxy-1,3,5-trinitrobenzene | NIST Chemistry WebBook |
| acide picrique | ChemIDplus |
| C.I. 10305 | ChemIDplus |
| CI 10305 | ChemIDplus |
| PICRIC ACID | PDBeChem |
| Pikrinsäure | ChemIDplus |
| Citations |
|---|