EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5N3O6 |
| Net Charge | 0 |
| Average Mass | 227.132 |
| Monoisotopic Mass | 227.01783 |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3 |
| InChIKey | SPSSULHKWOKEEL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trinitrotoluene (CHEBI:46053) has functional parent 1,3,5-trinitrobenzene (CHEBI:48113) |
| 2,4,6-trinitrotoluene (CHEBI:46053) has role explosive (CHEBI:63490) |
| 2,4,6-trinitrotoluene (CHEBI:46053) is a trinitrotoluene (CHEBI:27135) |
| IUPAC Name |
|---|
| 2-methyl-1,3,5-trinitrobenzene |
| Synonyms | Source |
|---|---|
| 1-methyl-2,4,6-trinitrobenzene | ChemIDplus |
| 2,4,6-TNT | NIST Chemistry WebBook |
| 2,4,6-trinitrotoluene | PDBeChem |
| 2,4,6-Trinitrotoluene | KEGG COMPOUND |
| 2,4,6-Trinitrotoluol | ChemIDplus |
| s-trinitrotoluene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2,4,6-trinitrotoluene | UniProt |
| Citations |
|---|