EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:45919 - tridecanoic acid
| Formula | C13H26O2 |
| Net Charge | 0 |
| Average Mass | 214.349 |
| Monoisotopic Mass | 214.19328 |
| SMILES | CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15) |
| InChIKey | SZHOJFHSIKHZHA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecanoic acid (CHEBI:45919) has role plant metabolite (CHEBI:76924) |
| tridecanoic acid (CHEBI:45919) is a long-chain fatty acid (CHEBI:15904) |
| tridecanoic acid (CHEBI:45919) is a straight-chain saturated fatty acid (CHEBI:39418) |
| tridecanoic acid (CHEBI:45919) is conjugate acid of tridecanoate (CHEBI:125832) |
| Incoming Relation(s) |
| (12R)-12-hydroxytridecanoic acid (CHEBI:78980) has functional parent tridecanoic acid (CHEBI:45919) |
| N-tridecanoylglycine (CHEBI:74437) has functional parent tridecanoic acid (CHEBI:45919) |
| N-tridecanoylsphingosine-1-phosphocholine (CHEBI:85023) has functional parent tridecanoic acid (CHEBI:45919) |
| 1-tridecanoyl-2-undecanoyl-sn-glycero-3-phosphocholine (CHEBI:86280) has functional parent tridecanoic acid (CHEBI:45919) |
| 1-undecanoyl-2-tridecanoyl-sn-glycero-3-phosphocholine (CHEBI:86278) has functional parent tridecanoic acid (CHEBI:45919) |
| 13-hydroxytridecanoic acid (CHEBI:79166) has functional parent tridecanoic acid (CHEBI:45919) |
| 2-hydroxytridecanoic acid (CHEBI:84852) has functional parent tridecanoic acid (CHEBI:45919) |
| tridecanoic-d25 acid (CHEBI:75084) has functional parent tridecanoic acid (CHEBI:45919) |
| tridecanoyl-CoA (CHEBI:85029) has functional parent tridecanoic acid (CHEBI:45919) |
| tridecanoate (CHEBI:125832) is conjugate base of tridecanoic acid (CHEBI:45919) |
| IUPAC Name |
|---|
| tridecanoic acid |
| Synonyms | Source |
|---|---|
| C13:0 | ChEBI |
| n-tridecanoic acid | ChemIDplus |
| N-TRIDECANOIC ACID | PDBeChem |
| n-tridecoic acid | ChemIDplus |
| tridecylic acid | ChemIDplus |