EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29NO3 |
| Net Charge | 0 |
| Average Mass | 271.401 |
| Monoisotopic Mass | 271.21474 |
| SMILES | CCCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C15H29NO3/c1-2-3-4-5-6-7-8-9-10-11-12-14(17)16-13-15(18)19/h2-13H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | BTHNNPTZHGZNAO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-tridecanoylglycine (CHEBI:74437) has functional parent glycine (CHEBI:15428) |
| N-tridecanoylglycine (CHEBI:74437) has functional parent tridecanoic acid (CHEBI:45919) |
| N-tridecanoylglycine (CHEBI:74437) has role metabolite (CHEBI:25212) |
| N-tridecanoylglycine (CHEBI:74437) is a N-acylglycine (CHEBI:16180) |
| N-tridecanoylglycine (CHEBI:74437) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| N-tridecanoylglycine |
| Synonym | Source |
|---|---|
| Acylglycine c:13 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013317 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6722306 | Reaxys |