EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26O3 |
| Net Charge | 0 |
| Average Mass | 230.348 |
| Monoisotopic Mass | 230.18819 |
| SMILES | CCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C13H26O3/c1-2-3-4-5-6-7-8-9-10-11-12(14)13(15)16/h12,14H,2-11H2,1H3,(H,15,16) |
| InChIKey | KCEUZVYQPROALO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mortierella alpina (ncbitaxon:64518) | - | PubMed (12191843) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxytridecanoic acid (CHEBI:84852) has functional parent tridecanoic acid (CHEBI:45919) |
| 2-hydroxytridecanoic acid (CHEBI:84852) has role fungal metabolite (CHEBI:76946) |
| 2-hydroxytridecanoic acid (CHEBI:84852) is a 2-hydroxy fatty acid (CHEBI:10283) |
| IUPAC Name |
|---|
| 2-hydroxytridecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-8469 | MetaCyc |
| LMFA01050040 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2087225 | Reaxys |
| Citations |
|---|