EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13HD25O2 |
| Net Charge | 0 |
| Average Mass | 239.502 |
| Monoisotopic Mass | 239.35020 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2 |
| InChIKey | SZHOJFHSIKHZHA-VVZIYBSUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecanoic-d25 acid (CHEBI:75084) has functional parent tridecanoic acid (CHEBI:45919) |
| tridecanoic-d25 acid (CHEBI:75084) is a deuterated fatty acid (CHEBI:75427) |
| tridecanoic-d25 acid (CHEBI:75084) is a long-chain fatty acid (CHEBI:15904) |
| tridecanoic-d25 acid (CHEBI:75084) is a straight-chain saturated fatty acid (CHEBI:39418) |
| IUPAC Name |
|---|
| (2H25)tridecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24533007 | ChemSpider |