EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25O2 |
| Net Charge | -1 |
| Average Mass | 213.341 |
| Monoisotopic Mass | 213.18600 |
| SMILES | CCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/p-1 |
| InChIKey | SZHOJFHSIKHZHA-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecanoate (CHEBI:125832) is a fatty acid anion 13:0 (CHEBI:78120) |
| tridecanoate (CHEBI:125832) is a long-chain fatty acid anion (CHEBI:57560) |
| tridecanoate (CHEBI:125832) is conjugate base of tridecanoic acid (CHEBI:45919) |
| Incoming Relation(s) |
| tridecanoic acid (CHEBI:45919) is conjugate acid of tridecanoate (CHEBI:125832) |
| IUPAC Name |
|---|
| tridecanoate |
| Synonym | Source |
|---|---|
| tridecanoic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| tridecanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3904805 | Reaxys |