EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO4 |
| Net Charge | 0 |
| Average Mass | 163.173 |
| Monoisotopic Mass | 163.08446 |
| SMILES | OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | LXBIFEVIBLOUGU-JGWLITMVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus amyloliquefaciens (ncbitaxon:1390) | - | PubMed (23265519) | |
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (23265519) | |
| Moraceae (ncbitaxon:3487) | - | PubMed (23909841) | |
| Morus alba (ncbitaxon:3498) | latex (BTO:0000710) | PubMed (27294120) |
| Roles Classification |
|---|
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| duvoglustat (CHEBI:44369) has role anti-HIV agent (CHEBI:64946) |
| duvoglustat (CHEBI:44369) has role anti-obesity agent (CHEBI:74518) |
| duvoglustat (CHEBI:44369) has role bacterial metabolite (CHEBI:76969) |
| duvoglustat (CHEBI:44369) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| duvoglustat (CHEBI:44369) has role hepatoprotective agent (CHEBI:62868) |
| duvoglustat (CHEBI:44369) has role hypoglycemic agent (CHEBI:35526) |
| duvoglustat (CHEBI:44369) has role plant metabolite (CHEBI:76924) |
| duvoglustat (CHEBI:44369) is a 2-(hydroxymethyl)piperidine-3,4,5-triol (CHEBI:72490) |
| duvoglustat (CHEBI:44369) is a piperidine alkaloid (CHEBI:26147) |
| Incoming Relation(s) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) has functional parent duvoglustat (CHEBI:44369) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has functional parent duvoglustat (CHEBI:44369) |
| N-nonyldeoxynojirimycin (CHEBI:76399) has functional parent duvoglustat (CHEBI:44369) |
| 1-deoxynojirimycin-1-sulfonic acid (CHEBI:167649) has functional parent duvoglustat (CHEBI:44369) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) has functional parent duvoglustat (CHEBI:44369) |
| miglustat (CHEBI:50381) has functional parent duvoglustat (CHEBI:44369) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| INN | Source |
|---|---|
| duvoglustat | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1,5-deoxy-1,5-imino-D-mannitol | DrugBank |
| 1,5-dideoxy-1,5-imino-D-glucitol | DrugBank |
| 1-Deoxymannojirimycin | DrugBank |
| (+)-1-Deoxynojirimycin | KNApSAcK |
| 1-Deoxynojirimycin | KEGG DRUG |
| 1-DEOXYNOJIRIMYCIN | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 1-Deoxynojirimycin | Wikipedia |
| 1-DEOXYNOJIRIMYCIN | MetaCyc |
| C00029420 | KNApSAcK |
| C16843 | KEGG COMPOUND |
| D09605 | KEGG DRUG |
| DB03206 | DrugBank |
| HMDB0035359 | HMDB |
| NOJ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1524395 | Reaxys |
| CAS:19130-96-2 | KEGG COMPOUND |
| CAS:19130-96-2 | ChemIDplus |
| Citations |
|---|