EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO4 |
| Net Charge | 0 |
| Average Mass | 163.173 |
| Monoisotopic Mass | 163.08446 |
| SMILES | OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | LXBIFEVIBLOUGU-JGWLITMVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus amyloliquefaciens (ncbitaxon:1390) | - | PubMed (23265519) | |
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (23265519) | |
| Moraceae (ncbitaxon:3487) | - | PubMed (23909841) | |
| Morus alba (ncbitaxon:3498) | latex (BTO:0000710) | PubMed (27294120) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-obesity agent Any substance which is used to reduce or control weight. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| duvoglustat (CHEBI:44369) has role anti-HIV agent (CHEBI:64946) |
| duvoglustat (CHEBI:44369) has role anti-obesity agent (CHEBI:74518) |
| duvoglustat (CHEBI:44369) has role bacterial metabolite (CHEBI:76969) |
| duvoglustat (CHEBI:44369) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| duvoglustat (CHEBI:44369) has role hepatoprotective agent (CHEBI:62868) |
| duvoglustat (CHEBI:44369) has role hypoglycemic agent (CHEBI:35526) |
| duvoglustat (CHEBI:44369) has role plant metabolite (CHEBI:76924) |
| duvoglustat (CHEBI:44369) is a 2-(hydroxymethyl)piperidine-3,4,5-triol (CHEBI:72490) |
| duvoglustat (CHEBI:44369) is a piperidine alkaloid (CHEBI:26147) |
| Incoming Relation(s) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) has functional parent duvoglustat (CHEBI:44369) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has functional parent duvoglustat (CHEBI:44369) |
| N-nonyldeoxynojirimycin (CHEBI:76399) has functional parent duvoglustat (CHEBI:44369) |
| 1-deoxynojirimycin-1-sulfonic acid (CHEBI:167649) has functional parent duvoglustat (CHEBI:44369) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) has functional parent duvoglustat (CHEBI:44369) |
| miglustat (CHEBI:50381) has functional parent duvoglustat (CHEBI:44369) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| INN | Source |
|---|---|
| duvoglustat | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1,5-deoxy-1,5-imino-D-mannitol | DrugBank |
| 1,5-dideoxy-1,5-imino- | ChEMBL |
| 1,5-dideoxy-1,5-imino-D-glucitol | DrugBank |
| 1-Deoxymannojirimycin | DrugBank |
| 1 deoxynojirimycin | ChEMBL |
| (+)-1-Deoxynojirimycin | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 1-Deoxynojirimycin | Wikipedia |
| 1-DEOXYNOJIRIMYCIN | MetaCyc |
| C00029420 | KNApSAcK |
| C16843 | KEGG COMPOUND |
| D09605 | KEGG DRUG |
| DB03206 | DrugBank |
| HMDB0035359 | HMDB |
| NOJ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1524395 | Reaxys |
| CAS:19130-96-2 | KEGG COMPOUND |
| CAS:19130-96-2 | ChemIDplus |
| Citations |
|---|