EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21NO4 |
| Net Charge | 0 |
| Average Mass | 219.281 |
| Monoisotopic Mass | 219.14706 |
| SMILES | CCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C10H21NO4/c1-2-3-4-11-5-8(13)10(15)9(14)7(11)6-12/h7-10,12-15H,2-6H2,1H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | UQRORFVVSGFNRO-UTINFBMNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 2.4.1.80 (ceramide glucosyltransferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the activity of ceramide glucosyltransferase (EC 2.4.1.80). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miglustat (CHEBI:50381) has functional parent duvoglustat (CHEBI:44369) |
| miglustat (CHEBI:50381) has role anti-HIV agent (CHEBI:64946) |
| miglustat (CHEBI:50381) has role EC 2.4.1.80 (ceramide glucosyltransferase) inhibitor (CHEBI:50382) |
| miglustat (CHEBI:50381) is a piperidines (CHEBI:26151) |
| miglustat (CHEBI:50381) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol |
| INNs | Source |
|---|---|
| miglustat | ChEBI |
| miglustatum | ChEBI |
| Synonyms | Source |
|---|---|
| BuDNJ | ChemIDplus |
| Butyldeoxynojirimycin | ChemIDplus |
| NB-DNJ | ChemIDplus |
| N-butyl-1-deoxynojirimycin | ChemIDplus |
| n-Butyl deoxynojirimycin | ChemIDplus |
| N-Butylmoranoline | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zavesca | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5862029 | Beilstein |
| CAS:72599-27-0 | ChemIDplus |