EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO4 |
| Net Charge | 0 |
| Average Mass | 191.227 |
| Monoisotopic Mass | 191.11576 |
| SMILES | CCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C8H17NO4/c1-2-9-3-6(11)8(13)7(12)5(9)4-10/h5-8,10-13H,2-4H2,1H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | DAYOICKCVBMUPS-ULAWRXDQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) has functional parent duvoglustat (CHEBI:44369) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) has role anti-HIV agent (CHEBI:64946) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) is a hydroxypiperidine (CHEBI:48590) |
| N-ethyl-1-deoxynojirimycin (CHEBI:167666) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol |
| Synonyms | Source |
|---|---|
| (2R,3R,4R,5S)-1-ethyl-2-(hydroxymethyl)-3,4,5-piperidinetriol | ChemIDplus |
| N-ethyldeoxynojirimycin | ChemIDplus |
| N-ethyl-DNJ | ChEBI |
| N-ethylmoranoline | ChemIDplus |
| EtDNJ | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 397723 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:72458-42-5 | NIST Chemistry WebBook |
| CAS:72458-42-5 | ChemIDplus |
| Citations |
|---|