EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO4 |
| Net Charge | 0 |
| Average Mass | 177.200 |
| Monoisotopic Mass | 177.10011 |
| SMILES | CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C7H15NO4/c1-8-2-5(10)7(12)6(11)4(8)3-9/h4-7,9-12H,2-3H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | AAKDPDFZMNYDLR-XZBKPIIZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus bombycis (ncbitaxon:66393) | leaf (BTO:0000713) | PubMed (8156550) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has functional parent duvoglustat (CHEBI:44369) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role anti-HIV agent (CHEBI:64946) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role cardioprotective agent (CHEBI:77307) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role plant metabolite (CHEBI:76924) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) is a hydroxypiperidine (CHEBI:48590) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) is a piperidine alkaloid (CHEBI:26147) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-2-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
| Synonyms | Source |
|---|---|
| N-methyldeoxynojirimycin | ChemIDplus |
| N-methyldesoxynojirimycin | ChemIDplus |
| N-methyl-DNJ | ChEBI |
| N-methyl-duvoglustat | ChEBI |
| MeDNJ | ChEBI |
| MOR-14 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 83403 | ChemSpider |
| C00051703 | KNApSAcK |
| FDB014032 | FooDB |
| HMDB0035360 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1524564 | Reaxys |
| CAS:69567-10-8 | NIST Chemistry WebBook |
| CAS:69567-10-8 | ChemIDplus |
| Citations |
|---|