EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO4 |
| Net Charge | 0 |
| Average Mass | 177.200 |
| Monoisotopic Mass | 177.10011 |
| SMILES | CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C7H15NO4/c1-8-2-5(10)7(12)6(11)4(8)3-9/h4-7,9-12H,2-3H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | AAKDPDFZMNYDLR-XZBKPIIZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus bombycis (ncbitaxon:66393) | leaf (BTO:0000713) | PubMed (8156550) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has functional parent duvoglustat (CHEBI:44369) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role anti-HIV agent (CHEBI:64946) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role cardioprotective agent (CHEBI:77307) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) has role plant metabolite (CHEBI:76924) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) is a hydroxypiperidine (CHEBI:48590) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) is a piperidine alkaloid (CHEBI:26147) |
| N-methyl-1-deoxynojirimycin (CHEBI:166564) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-2-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
| Synonyms | Source |
|---|---|
| N-methyldeoxynojirimycin | ChemIDplus |
| N-methyldesoxynojirimycin | ChemIDplus |
| MOR-14 | ChemIDplus |
| N-methyl-duvoglustat | ChEBI |
| MeDNJ | ChEBI |
| N-methyl-DNJ | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035360 | HMDB |
| 83403 | ChemSpider |
| C00051703 | KNApSAcK |
| FDB014032 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1524564 | Reaxys |
| CAS:69567-10-8 | ChemIDplus |
| CAS:69567-10-8 | NIST Chemistry WebBook |
| Citations |
|---|