EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO9 |
| Net Charge | 0 |
| Average Mass | 325.314 |
| Monoisotopic Mass | 325.13728 |
| SMILES | OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO9/c14-2-4-11(7(17)5(16)1-13-4)22-12-10(20)9(19)8(18)6(3-15)21-12/h4-20H,1-3H2/t4-,5+,6-,7-,8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | GNVIYGFSOIHFHK-NIKVEEOSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) has functional parent duvoglustat (CHEBI:44369) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) has functional parent α-D-glucose (CHEBI:17925) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) has role metabolite (CHEBI:25212) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) is a monosaccharide derivative (CHEBI:63367) |
| 4-O-α-D-glucopyranosylmoranoline (CHEBI:70736) is a α-D-glucoside (CHEBI:22390) |
| IUPAC Name |
|---|
| (2R,3R,4R,5S)-4,5-dihydroxy-2-(hydroxymethyl)piperidin-3-yl α-D-glucopyranoside |
| Synonym | Source |
|---|---|
| α-D-glucopyranosyl-(1→4)-1-deoxynojirimycin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5569174 | Reaxys |
| CAS:80312-32-9 | Reaxys |
| Citations |
|---|